C16H16ClNS — CID 79225982
2-(chloromethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline (PubChem CID 79225982) has the molecular formula C16H16ClNS and a molecular weight of 289.83 g/mol. Its IUPAC name is 2-(chloromethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline.
| Compound Name | 2-(chloromethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 79225982 |
| Molecular Formula | C16H16ClNS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-(chloromethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)aniline |
| SMILES | ClCc1ccccc1NCC1CSc2ccccc21 |
| InChI | InChI=1S/C16H16ClNS/c17-9-12-5-1-3-7-15(12)18-10-13-11-19-16-8-4-2-6-14(13)16/h1-8,13,18H,9-11H2 |
| InChIKey | LBLYOEZDUFJVHB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|