About 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline
2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline (PubChem CID 79221632) has the molecular formula C16H16BrNOS
and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline.
Molecular Properties
| Compound Name | 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline |
| PubChem CID | 79221632 |
| Molecular Formula | C16H16BrNOS |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline |
| SMILES | COc1ccc(Br)c(NCC2CSc3ccccc32)c1 |
| InChI | InChI=1S/C16H16BrNOS/c1-19-12-6-7-14(17)15(8-12)18-9-11-10-20-16-5-3-2-4-13(11)16/h2-8,11,18H,9-10H2,1H3 |
| InChIKey | SCVXQHPOMGJCID-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline?
The IUPAC name of 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline (CID 79221632) is 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline.
What is the SMILES notation for 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline?
The canonical SMILES for 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline is COc1ccc(Br)c(NCC2CSc3ccccc32)c1.
What is the InChIKey of 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline?
The InChIKey is SCVXQHPOMGJCID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNOS/c1-19-12-6-7-14(17)15(8-12)18-9-11-10-20-16-5-3-2-4-13(11)16/h2-8,11,18H,9-10H2,1H3.
What are the key properties of 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline?
2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline has a molecular weight of 350.28 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-5-methoxyaniline is sourced from PubChem (CID 79221632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).