C16H14ClNOS2 — CID 79206503
3-chloro-4-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzenecarbothioamide (PubChem CID 79206503) has the molecular formula C16H14ClNOS2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 3-chloro-4-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzenecarbothioamide.
| Compound Name | 3-chloro-4-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 79206503 |
| Molecular Formula | C16H14ClNOS2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3-chloro-4-(2,3-dihydro-1-benzothiophen-3-ylmethoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCC2CSc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClNOS2/c17-13-7-10(16(18)20)5-6-14(13)19-8-11-9-21-15-4-2-1-3-12(11)15/h1-7,11H,8-9H2,(H2,18,20) |
| InChIKey | OMUSGZJPHNJWTL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|