C14H16N2OS2 — CID 79215742
1-(2,3-dihydro-1-benzothiophene-2-carbonyl)pyrrolidine-2-carbothioamide (PubChem CID 79215742) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophene-2-carbonyl)pyrrolidine-2-carbothioamide.
| Compound Name | 1-(2,3-dihydro-1-benzothiophene-2-carbonyl)pyrrolidine-2-carbothioamide |
|---|---|
| PubChem CID | 79215742 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophene-2-carbonyl)pyrrolidine-2-carbothioamide |
| SMILES | NC(=S)C1CCCN1C(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H16N2OS2/c15-13(18)10-5-3-7-16(10)14(17)12-8-9-4-1-2-6-11(9)19-12/h1-2,4,6,10,12H,3,5,7-8H2,(H2,15,18) |
| InChIKey | JLFMCGQASJMJJP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|