C14H16N2O2S2 — CID 79674142
4-(2,3-dihydro-1-benzothiophene-2-carbonyl)morpholine-2-carbothioamide (PubChem CID 79674142) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophene-2-carbonyl)morpholine-2-carbothioamide.
| Compound Name | 4-(2,3-dihydro-1-benzothiophene-2-carbonyl)morpholine-2-carbothioamide |
|---|---|
| PubChem CID | 79674142 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophene-2-carbonyl)morpholine-2-carbothioamide |
| SMILES | NC(=S)C1CN(C(=O)C2Cc3ccccc3S2)CCO1 |
| InChI | InChI=1S/C14H16N2O2S2/c15-13(19)10-8-16(5-6-18-10)14(17)12-7-9-3-1-2-4-11(9)20-12/h1-4,10,12H,5-8H2,(H2,15,19) |
| InChIKey | SDJMOBBEJMJZOD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|