C13H19N3O4 — CID 79215858
4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79215858) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79215858 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-[(4-carbamoylpiperidine-1-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | NC(=O)C1CCN(C(=O)NC2C=CC(C(=O)O)C2)CC1 |
| InChI | InChI=1S/C13H19N3O4/c14-11(17)8-3-5-16(6-4-8)13(20)15-10-2-1-9(7-10)12(18)19/h1-2,8-10H,3-7H2,(H2,14,17)(H,15,20)(H,18,19) |
| InChIKey | ADZTYKIMHIJGBQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|