C14H23N3O3 — CID 79216190
4-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79216190) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79216190 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | CNCC1CCCN(C(=O)NC2C=CC(C(=O)O)C2)C1 |
| InChI | InChI=1S/C14H23N3O3/c1-15-8-10-3-2-6-17(9-10)14(20)16-12-5-4-11(7-12)13(18)19/h4-5,10-12,15H,2-3,6-9H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | IFMYAENSOPGYEI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|