C13H16N2O3S — CID 79216506
4-(1-thiophen-3-ylethylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid (PubChem CID 79216506) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-(1-thiophen-3-ylethylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-(1-thiophen-3-ylethylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79216506 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-(1-thiophen-3-ylethylcarbamoylamino)cyclopent-2-ene-1-carboxylic acid |
| SMILES | CC(NC(=O)NC1C=CC(C(=O)O)C1)c1ccsc1 |
| InChI | InChI=1S/C13H16N2O3S/c1-8(10-4-5-19-7-10)14-13(18)15-11-3-2-9(6-11)12(16)17/h2-5,7-9,11H,6H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | BOSCUCQIWZRWTG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|