C12H18N4 — CID 79216796
4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)cyclopent-2-en-1-amine (PubChem CID 79216796) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 79216796 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C12H18N4/c13-10-6-5-9(8-10)12-15-14-11-4-2-1-3-7-16(11)12/h5-6,9-10H,1-4,7-8,13H2 |
| InChIKey | AADCMAGFOZXQEE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|