C15H19NO4S — CID 79218939
2-acetamido-4-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)butanoic acid (PubChem CID 79218939) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-acetamido-4-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)butanoic acid.
| Compound Name | 2-acetamido-4-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 79218939 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-acetamido-4-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)butanoic acid |
| SMILES | CC(=O)NC(CCSCC1COc2ccccc21)C(=O)O |
| InChI | InChI=1S/C15H19NO4S/c1-10(17)16-13(15(18)19)6-7-21-9-11-8-20-14-5-3-2-4-12(11)14/h2-5,11,13H,6-9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | MKUUMZIQMSFVDQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|