C15H17ClN2O2 — CID 79220424
2-[1-(2-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid (PubChem CID 79220424) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid.
| Compound Name | 2-[1-(2-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 79220424 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-3,5-diethylpyrazol-4-yl]acetic acid |
| SMILES | CCc1nn(-c2ccccc2Cl)c(CC)c1CC(=O)O |
| InChI | InChI=1S/C15H17ClN2O2/c1-3-12-10(9-15(19)20)13(4-2)18(17-12)14-8-6-5-7-11(14)16/h5-8H,3-4,9H2,1-2H3,(H,19,20) |
| InChIKey | PTQVQZFDARYIBI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |