C14H20N4S — CID 79228500
N-[[2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methyl]propan-1-amine (PubChem CID 79228500) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is N-[[2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 79228500 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-[[2-(2-phenylsulfanylethyl)-1,2,4-triazol-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ncnn1CCSc1ccccc1 |
| InChI | InChI=1S/C14H20N4S/c1-2-8-15-11-14-16-12-17-18(14)9-10-19-13-6-4-3-5-7-13/h3-7,12,15H,2,8-11H2,1H3 |
| InChIKey | WMXVTACSSBLBAD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|