C12H23BrN4 — CID 107844546
6-bromo-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine (PubChem CID 107844546) has the molecular formula C12H23BrN4 and a molecular weight of 303.25 g/mol. Its IUPAC name is 6-bromo-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine.
| Compound Name | 6-bromo-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 107844546 |
| Molecular Formula | C12H23BrN4 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 6-bromo-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine |
| SMILES | CCCn1ncnc1CNCCCCCCBr |
| InChI | InChI=1S/C12H23BrN4/c1-2-9-17-12(15-11-16-17)10-14-8-6-4-3-5-7-13/h11,14H,2-10H2,1H3 |
| InChIKey | OHOXGLHXVMRLBL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|