C10H14ClN3O3 — CID 79238382
2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoyl]propanamide (PubChem CID 79238382) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 79238382 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylcarbamoyl]propanamide |
| SMILES | Cc1noc(C)c1CNC(=O)NC(=O)C(C)Cl |
| InChI | InChI=1S/C10H14ClN3O3/c1-5(11)9(15)13-10(16)12-4-8-6(2)14-17-7(8)3/h5H,4H2,1-3H3,(H2,12,13,15,16) |
| InChIKey | BLOUMXXNCJVRKQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|