C10H23N3O — CID 79249185
1-tert-butyl-2-[(2S)-1-hydroxy-3-methylbutan-2-yl]guanidine (PubChem CID 79249185) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-tert-butyl-2-[(2S)-1-hydroxy-3-methylbutan-2-yl]guanidine.
| Compound Name | 1-tert-butyl-2-[(2S)-1-hydroxy-3-methylbutan-2-yl]guanidine |
|---|---|
| PubChem CID | 79249185 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1-tert-butyl-2-[(2S)-1-hydroxy-3-methylbutan-2-yl]guanidine |
| SMILES | CC(C)[C@@H](CO)/N=C(\N)NC(C)(C)C |
| InChI | InChI=1S/C10H23N3O/c1-7(2)8(6-14)12-9(11)13-10(3,4)5/h7-8,14H,6H2,1-5H3,(H3,11,12,13)/t8-/m1/s1 |
| InChIKey | LUCCSGLLWNHMCO-MRVPVSSYSA-N |
| XLogP | 0.71 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|