C17H12N2O3 — CID 7925435
[4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 7925435) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7925435 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C17H12N2O3/c20-16(11-6-13-4-2-1-3-5-13)22-15-9-7-14(8-10-15)17-19-18-12-21-17/h1-12H/b11-6+ |
| InChIKey | AJIIIWIYPQTCJO-IZZDOVSWSA-N |
| XLogP | 3.36 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|