C21H14N2O3S — CID 8893959
[4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 8893959) has the molecular formula C21H14N2O3S and a molecular weight of 374.42 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8893959 |
| Molecular Formula | C21H14N2O3S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)s1)Oc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C21H14N2O3S/c24-20(26-17-8-6-16(7-9-17)21-23-22-14-25-21)13-11-18-10-12-19(27-18)15-4-2-1-3-5-15/h1-14H/b13-11+ |
| InChIKey | OZTUHDXEALHVCQ-ACCUITESSA-N |
| XLogP | 5.08 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|