C13H15N3O3S — CID 79264269
2-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)-prop-2-enylamino]acetic acid (PubChem CID 79264269) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79264269 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[(1,3-dimethylthieno[3,2-d]pyrazole-5-carbonyl)-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)c1cc2c(C)nn(C)c2s1 |
| InChI | InChI=1S/C13H15N3O3S/c1-4-5-16(7-11(17)18)12(19)10-6-9-8(2)14-15(3)13(9)20-10/h4,6H,1,5,7H2,2-3H3,(H,17,18) |
| InChIKey | RDAMGMFEICSIHC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|