C14H20FNO2S — CID 79269027
2-[tert-butyl-[2-(4-fluorophenyl)sulfanylethyl]amino]acetic acid (PubChem CID 79269027) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-[tert-butyl-[2-(4-fluorophenyl)sulfanylethyl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[2-(4-fluorophenyl)sulfanylethyl]amino]acetic acid |
|---|---|
| PubChem CID | 79269027 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[tert-butyl-[2-(4-fluorophenyl)sulfanylethyl]amino]acetic acid |
| SMILES | CC(C)(C)N(CCSc1ccc(F)cc1)CC(=O)O |
| InChI | InChI=1S/C14H20FNO2S/c1-14(2,3)16(10-13(17)18)8-9-19-12-6-4-11(15)5-7-12/h4-7H,8-10H2,1-3H3,(H,17,18) |
| InChIKey | RPCRNKGWEGKMPB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |