C14H12N2O3S2 — CID 79271382
2-[prop-2-ynyl-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetic acid (PubChem CID 79271382) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[prop-2-ynyl-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[prop-2-ynyl-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 79271382 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-[prop-2-ynyl-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetic acid |
| SMILES | C#CCN(CC(=O)O)C(=O)Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C14H12N2O3S2/c1-2-4-16(7-13(18)19)12(17)6-11-9-21-14(15-11)10-3-5-20-8-10/h1,3,5,8-9H,4,6-7H2,(H,18,19) |
| InChIKey | VFLBYUAIBGAAGL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|