C14H14N4O2S — CID 79273431
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79273431) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79273431 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H14N4O2S/c1-8-12-13(17(2)16-8)18(14(21)15-12)9-3-4-10-11(7-9)20-6-5-19-10/h3-4,7H,5-6H2,1-2H3,(H,15,21) |
| InChIKey | RUUAFYCMTXMVHL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|