C16H18ClN3S — CID 79274266
2-(1-chloroethyl)-1-[1-(2,5-dimethylthiophen-3-yl)ethyl]imidazo[4,5-c]pyridine (PubChem CID 79274266) has the molecular formula C16H18ClN3S and a molecular weight of 319.86 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-[1-(2,5-dimethylthiophen-3-yl)ethyl]imidazo[4,5-c]pyridine.
| Compound Name | 2-(1-chloroethyl)-1-[1-(2,5-dimethylthiophen-3-yl)ethyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79274266 |
| Molecular Formula | C16H18ClN3S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-(1-chloroethyl)-1-[1-(2,5-dimethylthiophen-3-yl)ethyl]imidazo[4,5-c]pyridine |
| SMILES | Cc1cc(C(C)n2c(C(C)Cl)nc3cnccc32)c(C)s1 |
| InChI | InChI=1S/C16H18ClN3S/c1-9-7-13(12(4)21-9)11(3)20-15-5-6-18-8-14(15)19-16(20)10(2)17/h5-8,10-11H,1-4H3 |
| InChIKey | VCXBGBPPLAVWRB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|