C15H20BrClN4 — CID 79280245
6-bromo-2-(1-chloroethyl)-3-(1-ethylpiperidin-3-yl)imidazo[4,5-b]pyridine (PubChem CID 79280245) has the molecular formula C15H20BrClN4 and a molecular weight of 371.71 g/mol. Its IUPAC name is 6-bromo-2-(1-chloroethyl)-3-(1-ethylpiperidin-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(1-chloroethyl)-3-(1-ethylpiperidin-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79280245 |
| Molecular Formula | C15H20BrClN4 |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 6-bromo-2-(1-chloroethyl)-3-(1-ethylpiperidin-3-yl)imidazo[4,5-b]pyridine |
| SMILES | CCN1CCCC(n2c(C(C)Cl)nc3cc(Br)cnc32)C1 |
| InChI | InChI=1S/C15H20BrClN4/c1-3-20-6-4-5-12(9-20)21-14(10(2)17)19-13-7-11(16)8-18-15(13)21/h7-8,10,12H,3-6,9H2,1-2H3 |
| InChIKey | ZTQSBJPNJNSWKB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|