C13H12BrClN4O2 — CID 79279739
3-[6-bromo-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]piperidine-2,6-dione (PubChem CID 79279739) has the molecular formula C13H12BrClN4O2 and a molecular weight of 371.62 g/mol. Its IUPAC name is 3-[6-bromo-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-bromo-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 79279739 |
| Molecular Formula | C13H12BrClN4O2 |
| Molecular Weight | 371.62 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 3-[6-bromo-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]piperidine-2,6-dione |
| SMILES | CC(Cl)c1nc2cc(Br)cnc2n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H12BrClN4O2/c1-6(15)11-17-8-4-7(14)5-16-12(8)19(11)9-2-3-10(20)18-13(9)21/h4-6,9H,2-3H2,1H3,(H,18,20,21) |
| InChIKey | ZAADTWRCXJBNGC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|