C13H17BrN2O — CID 79285163
N-(4-bromo-2,6-dimethylphenyl)-2-(prop-2-enylamino)acetamide (PubChem CID 79285163) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79285163 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C13H17BrN2O/c1-4-5-15-8-12(17)16-13-9(2)6-11(14)7-10(13)3/h4,6-7,15H,1,5,8H2,2-3H3,(H,16,17) |
| InChIKey | ZZQODKTVHRAQQC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|