C16H11BrF5NO — CID 123313382
N-(4-bromo-2,6-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 123313382) has the molecular formula C16H11BrF5NO and a molecular weight of 408.16 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 123313382 |
| Molecular Formula | C16H11BrF5NO |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H11BrF5NO/c1-6-3-8(17)4-7(2)16(6)23-10(24)5-9-11(18)13(20)15(22)14(21)12(9)19/h3-4H,5H2,1-2H3,(H,23,24) |
| InChIKey | JLYZYJBECWYRAY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|