C11H13N5O — CID 79289184
3-(2-aminoimidazo[4,5-b]pyridin-3-yl)piperidin-2-one (PubChem CID 79289184) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 3-(2-aminoimidazo[4,5-b]pyridin-3-yl)piperidin-2-one.
| Compound Name | 3-(2-aminoimidazo[4,5-b]pyridin-3-yl)piperidin-2-one |
|---|---|
| PubChem CID | 79289184 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-(2-aminoimidazo[4,5-b]pyridin-3-yl)piperidin-2-one |
| SMILES | Nc1nc2cccnc2n1C1CCCNC1=O |
| InChI | InChI=1S/C11H13N5O/c12-11-15-7-3-1-5-13-9(7)16(11)8-4-2-6-14-10(8)17/h1,3,5,8H,2,4,6H2,(H2,12,15)(H,14,17) |
| InChIKey | IDDFDAOLMBWMNV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |