About 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione
3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79289312) has the molecular formula C14H15N3S2
and a molecular weight of 289.43 g/mol. Its IUPAC name is 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
Molecular Properties
| Compound Name | 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| PubChem CID | 79289312 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1cc(C(C)n2c(=S)[nH]c3cccnc32)c(C)s1 |
| InChI | InChI=1S/C14H15N3S2/c1-8-7-11(10(3)19-8)9(2)17-13-12(16-14(17)18)5-4-6-15-13/h4-7,9H,1-3H3,(H,16,18) |
| InChIKey | OFXGAUHDEBYNIO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
The IUPAC name of 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (CID 79289312) is 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
What is the SMILES notation for 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
The canonical SMILES for 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione is Cc1cc(C(C)n2c(=S)[nH]c3cccnc32)c(C)s1.
What is the InChIKey of 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
The InChIKey is OFXGAUHDEBYNIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3S2/c1-8-7-11(10(3)19-8)9(2)17-13-12(16-14(17)18)5-4-6-15-13/h4-7,9H,1-3H3,(H,16,18).
What are the key properties of 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione?
3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione has a molecular weight of 289.43 g/mol, XLogP of 4.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione is sourced from PubChem (CID 79289312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).