C16H19BrO3 — CID 79298958
methyl 7-bromo-2'-propan-2-ylspiro[2,4-dihydro-1H-naphthalene-3,3'-oxirane]-2'-carboxylate (PubChem CID 79298958) has the molecular formula C16H19BrO3 and a molecular weight of 339.23 g/mol. Its IUPAC name is methyl 7-bromo-2'-propan-2-ylspiro[2,4-dihydro-1H-naphthalene-3,3'-oxirane]-2'-carboxylate.
| Compound Name | methyl 7-bromo-2'-propan-2-ylspiro[2,4-dihydro-1H-naphthalene-3,3'-oxirane]-2'-carboxylate |
|---|---|
| PubChem CID | 79298958 |
| Molecular Formula | C16H19BrO3 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | methyl 7-bromo-2'-propan-2-ylspiro[2,4-dihydro-1H-naphthalene-3,3'-oxirane]-2'-carboxylate |
| SMILES | COC(=O)C1(C(C)C)OC12CCc1cc(Br)ccc1C2 |
| InChI | InChI=1S/C16H19BrO3/c1-10(2)16(14(18)19-3)15(20-16)7-6-11-8-13(17)5-4-12(11)9-15/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | QTXIQMBWWABZLS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|