2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid

C11H20O3 — CID 79303348

IUPAC2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid
SMILESCC1CCC(C(C)(O)C(=O)O)C(C)C1
InChIInChI=1S/C11H20O3/c1-7-4-5-9(8(2)6-7)11(3,14)10(12)13/h7-9,14H,4-6H2,1-3H3,(H,12,13)
InChIKeyAWKMCERFXNSVTL-UHFFFAOYSA-N
MW200.28 g/mol
LogP1.89
Rot. Bonds2

About 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid

2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid (PubChem CID 79303348) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid.

Molecular Properties

Compound Name2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid
PubChem CID79303348
Molecular FormulaC11H20O3
Molecular Weight200.28 g/mol
Exact Mass200.14
IUPAC Name2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid
SMILESCC1CCC(C(C)(O)C(=O)O)C(C)C1
InChIInChI=1S/C11H20O3/c1-7-4-5-9(8(2)6-7)11(3,14)10(12)13/h7-9,14H,4-6H2,1-3H3,(H,12,13)
InChIKeyAWKMCERFXNSVTL-UHFFFAOYSA-N
XLogP1.89
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 51.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid?
The IUPAC name of 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid (CID 79303348) is 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid.
What is the SMILES notation for 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid?
The canonical SMILES for 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid is CC1CCC(C(C)(O)C(=O)O)C(C)C1.
What is the InChIKey of 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid?
The InChIKey is AWKMCERFXNSVTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-7-4-5-9(8(2)6-7)11(3,14)10(12)13/h7-9,14H,4-6H2,1-3H3,(H,12,13).
What are the key properties of 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid?
2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid has a molecular weight of 200.28 g/mol, XLogP of 1.89, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylcyclohexyl)-2-hydroxypropanoic acid is sourced from PubChem (CID 79303348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).