C19H13ClF3NO2 — CID 7930859
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 7930859) has the molecular formula C19H13ClF3NO2 and a molecular weight of 379.77 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 7930859 |
| Molecular Formula | C19H13ClF3NO2 |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13ClF3NO2/c1-26-17-9-12-5-3-2-4-11(12)8-14(17)18(25)24-13-6-7-16(20)15(10-13)19(21,22)23/h2-10H,1H3,(H,24,25) |
| InChIKey | GQLQJGILSXMFCI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |