C23H18ClFO4 — CID 7931070
[4-(4-fluorobenzoyl)phenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate (PubChem CID 7931070) has the molecular formula C23H18ClFO4 and a molecular weight of 412.84 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)phenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate.
| Compound Name | [4-(4-fluorobenzoyl)phenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 7931070 |
| Molecular Formula | C23H18ClFO4 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [4-(4-fluorobenzoyl)phenyl] 2-(4-chloro-2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cc(Cl)cc(C)c1OCC(=O)Oc1ccc(C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H18ClFO4/c1-14-11-18(24)12-15(2)23(14)28-13-21(26)29-20-9-5-17(6-10-20)22(27)16-3-7-19(25)8-4-16/h3-12H,13H2,1-2H3 |
| InChIKey | VWARANNUORNLIF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|