C13H12ClFN4O2 — CID 79311302
1-[1-[(2-chloro-6-fluorophenyl)methyl]azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79311302) has the molecular formula C13H12ClFN4O2 and a molecular weight of 310.72 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79311302 |
| Molecular Formula | C13H12ClFN4O2 |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CN(Cc3c(F)cccc3Cl)C2)nn1 |
| InChI | InChI=1S/C13H12ClFN4O2/c14-10-2-1-3-11(15)9(10)6-18-4-8(5-18)19-7-12(13(20)21)16-17-19/h1-3,7-8H,4-6H2,(H,20,21) |
| InChIKey | UZSDETCBCOFKDJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |