C10H15NO2S — CID 79318263
11-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione (PubChem CID 79318263) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 11-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 11-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 79318263 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 11-methyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC1C(=O)NC(=O)CC12CCCSC2 |
| InChI | InChI=1S/C10H15NO2S/c1-7-9(13)11-8(12)5-10(7)3-2-4-14-6-10/h7H,2-6H2,1H3,(H,11,12,13) |
| InChIKey | OGUPGIFHRWRDIY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|