C11H15NO2 — CID 130525151
3'-methylspiro[bicyclo[3.1.0]hexane-2,4'-piperidine]-2',6'-dione (PubChem CID 130525151) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3'-methylspiro[bicyclo[3.1.0]hexane-2,4'-piperidine]-2',6'-dione.
| Compound Name | 3'-methylspiro[bicyclo[3.1.0]hexane-2,4'-piperidine]-2',6'-dione |
|---|---|
| PubChem CID | 130525151 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3'-methylspiro[bicyclo[3.1.0]hexane-2,4'-piperidine]-2',6'-dione |
| SMILES | CC1C(=O)NC(=O)CC12CCC1CC12 |
| InChI | InChI=1S/C11H15NO2/c1-6-10(14)12-9(13)5-11(6)3-2-7-4-8(7)11/h6-8H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | RDPAIWBLZPGCJU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|