C17H21NO2 — CID 79318412
3-benzyl-4-cyclopropyl-4-ethylpiperidine-2,6-dione (PubChem CID 79318412) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-benzyl-4-cyclopropyl-4-ethylpiperidine-2,6-dione.
| Compound Name | 3-benzyl-4-cyclopropyl-4-ethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 79318412 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-benzyl-4-cyclopropyl-4-ethylpiperidine-2,6-dione |
| SMILES | CCC1(C2CC2)CC(=O)NC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-2-17(13-8-9-13)11-15(19)18-16(20)14(17)10-12-6-4-3-5-7-12/h3-7,13-14H,2,8-11H2,1H3,(H,18,19,20) |
| InChIKey | MUYLEBJMSBDMRZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|