C13H14BrN5O2 — CID 79319018
1-(azetidin-3-yl)-N-(5-bromo-2-methoxyphenyl)triazole-4-carboxamide (PubChem CID 79319018) has the molecular formula C13H14BrN5O2 and a molecular weight of 352.19 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-(5-bromo-2-methoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1-(azetidin-3-yl)-N-(5-bromo-2-methoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 79319018 |
| Molecular Formula | C13H14BrN5O2 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 1-(azetidin-3-yl)-N-(5-bromo-2-methoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1ccc(Br)cc1NC(=O)c1cn(C2CNC2)nn1 |
| InChI | InChI=1S/C13H14BrN5O2/c1-21-12-3-2-8(14)4-10(12)16-13(20)11-7-19(18-17-11)9-5-15-6-9/h2-4,7,9,15H,5-6H2,1H3,(H,16,20) |
| InChIKey | MUYWOJQOVZYTJJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |