C18H27NO — CID 79320927
4-(2,2-dimethyl-3H-1-benzofuran-7-yl)-3-propan-2-ylpiperidine (PubChem CID 79320927) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 4-(2,2-dimethyl-3H-1-benzofuran-7-yl)-3-propan-2-ylpiperidine.
| Compound Name | 4-(2,2-dimethyl-3H-1-benzofuran-7-yl)-3-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 79320927 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 4-(2,2-dimethyl-3H-1-benzofuran-7-yl)-3-propan-2-ylpiperidine |
| SMILES | CC(C)C1CNCCC1c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C18H27NO/c1-12(2)16-11-19-9-8-14(16)15-7-5-6-13-10-18(3,4)20-17(13)15/h5-7,12,14,16,19H,8-11H2,1-4H3 |
| InChIKey | IDICHBUOWHFSBU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |