C16H23NO2 — CID 65126843
2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-ethylmorpholine (PubChem CID 65126843) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-ethylmorpholine.
| Compound Name | 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-ethylmorpholine |
|---|---|
| PubChem CID | 65126843 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-(2,2-dimethyl-3H-1-benzofuran-7-yl)-6-ethylmorpholine |
| SMILES | CCC1CNCC(c2cccc3c2OC(C)(C)C3)O1 |
| InChI | InChI=1S/C16H23NO2/c1-4-12-9-17-10-14(18-12)13-7-5-6-11-8-16(2,3)19-15(11)13/h5-7,12,14,17H,4,8-10H2,1-3H3 |
| InChIKey | VZWQZUCBVDHILT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |