C17H17F3N2O5 — CID 7932470
[(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932470) has the molecular formula C17H17F3N2O5 and a molecular weight of 386.33 g/mol. Its IUPAC name is [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932470 |
| Molecular Formula | C17H17F3N2O5 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@H]1CC=CCC1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O5/c1-10(27-16(24)11-5-3-2-4-6-11)15(23)21-14-8-7-12(22(25)26)9-13(14)17(18,19)20/h2-3,7-11H,4-6H2,1H3,(H,21,23)/t10-,11+/m1/s1 |
| InChIKey | CDNXWEXWUDXRLC-MNOVXSKESA-N |
| XLogP | 3.84 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|