C14H15NO5 — CID 79324954
3-(2,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 79324954) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-(2,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-(2,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79324954 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-(2,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | COc1cc(OC)c(-c2cc[nH]c2C(=O)O)cc1OC |
| InChI | InChI=1S/C14H15NO5/c1-18-10-7-12(20-3)11(19-2)6-9(10)8-4-5-15-13(8)14(16)17/h4-7,15H,1-3H3,(H,16,17) |
| InChIKey | FWXBKHGPCXANNT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |