C19H21NO3 — CID 7932524
[(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932524) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932524 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (1R)-cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@@H](C)OC(=O)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C19H21NO3/c1-12-17(15-10-6-7-11-16(15)20-12)18(21)13(2)23-19(22)14-8-4-3-5-9-14/h3-4,6-7,10-11,13-14,20H,5,8-9H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | FXLYXKVUKQDDMS-KGLIPLIRSA-N |
| XLogP | 3.95 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|