C11H9F3O3S — CID 79326800
4-(oxetan-3-ylsulfanyl)-2-(trifluoromethyl)benzoic acid (PubChem CID 79326800) has the molecular formula C11H9F3O3S and a molecular weight of 278.25 g/mol. Its IUPAC name is 4-(oxetan-3-ylsulfanyl)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(oxetan-3-ylsulfanyl)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 79326800 |
| Molecular Formula | C11H9F3O3S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 4-(oxetan-3-ylsulfanyl)-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(SC2COC2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9F3O3S/c12-11(13,14)9-3-6(18-7-4-17-5-7)1-2-8(9)10(15)16/h1-3,7H,4-5H2,(H,15,16) |
| InChIKey | VCPWAPZZXBCYOF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |