C13H17Cl — CID 79334693
2-[2-(chloromethyl)but-1-enyl]-1,4-dimethylbenzene (PubChem CID 79334693) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 2-[2-(chloromethyl)but-1-enyl]-1,4-dimethylbenzene.
| Compound Name | 2-[2-(chloromethyl)but-1-enyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 79334693 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-[2-(chloromethyl)but-1-enyl]-1,4-dimethylbenzene |
| SMILES | CCC(=Cc1cc(C)ccc1C)CCl |
| InChI | InChI=1S/C13H17Cl/c1-4-12(9-14)8-13-7-10(2)5-6-11(13)3/h5-8H,4,9H2,1-3H3 |
| InChIKey | HKQBOXCUQZUPHR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|