C14H23NO — CID 79339615
3-methyl-2-[(5-methylfuran-2-yl)methylidene]-N-propylbutan-1-amine (PubChem CID 79339615) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-methyl-2-[(5-methylfuran-2-yl)methylidene]-N-propylbutan-1-amine.
| Compound Name | 3-methyl-2-[(5-methylfuran-2-yl)methylidene]-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79339615 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-methyl-2-[(5-methylfuran-2-yl)methylidene]-N-propylbutan-1-amine |
| SMILES | CCCNCC(=Cc1ccc(C)o1)C(C)C |
| InChI | InChI=1S/C14H23NO/c1-5-8-15-10-13(11(2)3)9-14-7-6-12(4)16-14/h6-7,9,11,15H,5,8,10H2,1-4H3 |
| InChIKey | MQIQICAKPFPYSB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|