C17H26ClNO2 — CID 79342185
2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3-methyl-N-propylbutan-1-amine (PubChem CID 79342185) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is 2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3-methyl-N-propylbutan-1-amine.
| Compound Name | 2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79342185 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-[(2-chloro-3,4-dimethoxyphenyl)methylidene]-3-methyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(=Cc1ccc(OC)c(OC)c1Cl)C(C)C |
| InChI | InChI=1S/C17H26ClNO2/c1-6-9-19-11-14(12(2)3)10-13-7-8-15(20-4)17(21-5)16(13)18/h7-8,10,12,19H,6,9,11H2,1-5H3 |
| InChIKey | GXIOZLDPTLYXTK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|