C13H16F3NO — CID 79340063
N-ethyl-2-methyl-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-amine (PubChem CID 79340063) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is N-ethyl-2-methyl-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-amine.
| Compound Name | N-ethyl-2-methyl-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 79340063 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-ethyl-2-methyl-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-amine |
| SMILES | CCNCC(C)=Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H16F3NO/c1-3-17-9-10(2)8-11-6-4-5-7-12(11)18-13(14,15)16/h4-8,17H,3,9H2,1-2H3 |
| InChIKey | MHNABBXOYRBOSO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |