C14H19Br2NO2 — CID 79340767
3-(3,5-dibromo-4-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-en-1-amine (PubChem CID 79340767) has the molecular formula C14H19Br2NO2 and a molecular weight of 393.12 g/mol. Its IUPAC name is 3-(3,5-dibromo-4-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-en-1-amine.
| Compound Name | 3-(3,5-dibromo-4-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 79340767 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 3-(3,5-dibromo-4-ethoxyphenyl)-N-(2-methoxyethyl)prop-2-en-1-amine |
| SMILES | CCOc1c(Br)cc(C=CCNCCOC)cc1Br |
| InChI | InChI=1S/C14H19Br2NO2/c1-3-19-14-12(15)9-11(10-13(14)16)5-4-6-17-7-8-18-2/h4-5,9-10,17H,3,6-8H2,1-2H3 |
| InChIKey | OHXPBBNZRJLDNC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|