C15H17NO3 — CID 79349046
2-hydroxyethyl N-(1-naphthalen-1-ylethyl)carbamate (PubChem CID 79349046) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-hydroxyethyl N-(1-naphthalen-1-ylethyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(1-naphthalen-1-ylethyl)carbamate |
|---|---|
| PubChem CID | 79349046 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-hydroxyethyl N-(1-naphthalen-1-ylethyl)carbamate |
| SMILES | CC(NC(=O)OCCO)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H17NO3/c1-11(16-15(18)19-10-9-17)13-8-4-6-12-5-2-3-7-14(12)13/h2-8,11,17H,9-10H2,1H3,(H,16,18) |
| InChIKey | GPHXREDSTHTMAT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |