C18H17ClO2 — CID 7935420
(2,3,6-trimethylphenyl) (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 7935420) has the molecular formula C18H17ClO2 and a molecular weight of 300.79 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | (2,3,6-trimethylphenyl) (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7935420 |
| Molecular Formula | C18H17ClO2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2,3,6-trimethylphenyl) (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(C)c(OC(=O)/C=C/c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C18H17ClO2/c1-12-4-5-13(2)18(14(12)3)21-17(20)11-8-15-6-9-16(19)10-7-15/h4-11H,1-3H3/b11-8+ |
| InChIKey | DCNJMOBEJMMMDQ-DHZHZOJOSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|